A8508032
(1S,2R,5R)-(+)-Isomenthol , 95% , 23283-97-8
Synonym(s):
(1S,2R,5R)-2-Isopropyl-5-methylcyclohexanol
CAS NO.:23283-97-8
Empirical Formula: C10H20O
Molecular Weight: 156.27
MDL number: MFCD00062984
EINECS: 245-554-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB239.20 | In Stock |
|
| 1G | RMB639.20 | In Stock |
|
| 5g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-83°C |
| Boiling point: | 218-219°C |
| Density | 0,9 g/cm3 |
| refractive index | 1.4590 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethanol (Sparingly), Methanol (Slightly) |
| pka | 15.30±0.60(Predicted) |
| form | crystals |
| color | White to Off-White |
| Odor | at 10.00 % in dipropylene glycol. musty sweet herbal earthy camphor hay |
| Odor Type | musty |
| optical activity | [α]20/D 25.5±2.0°, c = 0.5 in ethanol |
| BRN | 1902291 |
| Major Application | food and beverages |
| InChI | 1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9-,10+/m1/s1 |
| InChIKey | NOOLISFMXDJSKH-BBBLOLIVSA-N |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1O |
| LogP | 3.190 |
| CAS DataBase Reference | 23283-97-8(CAS DataBase Reference) |
| EPA Substance Registry System | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1S,2R,5R)- (23283-97-8) |
Description and Uses
(+)-Isomenthol is a reagent that has been used in the preparation of a phosphine activator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2906190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |






![(2S)-2-[[[(1,1-Dimethylethyl)diphenylsilyl]oxy]methyl]-1,3-oxathiolan-5-ol 5-Acetate](https://img.chemicalbook.com/CAS/20180601/GIF/202532-88-5.gif)