A8524032
4-Methyl-3-nitrobenzoyl chloride , 98% , 10397-30-5
Synonym(s):
3-Nitro-p-toluoyl chloride
CAS NO.:10397-30-5
Empirical Formula: C8H6ClNO3
Molecular Weight: 199.59
MDL number: MFCD00035747
EINECS: 233-858-1
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB71.20 | In Stock |
|
| 10ML | RMB143.20 | In Stock |
|
| 50ML | RMB559.20 | In Stock |
|
| 250ml | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20-21 °C(lit.) |
| Boiling point: | 185 °C36 mm Hg(lit.) |
| Density | 1.37 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | liquid |
| InChI | 1S/C8H6ClNO3/c1-5-2-3-6(8(9)11)4-7(5)10(12)13/h2-4H,1H3 |
| InChIKey | DXMHBBURYDVYAI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1[N+]([O-])=O)C(Cl)=O |
| CAS DataBase Reference | 10397-30-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Methyl-3-nitrobenzoyl chloride(10397-30-5) |
Description and Uses
4-Methyl-3-nitrobenzoyl chloride was used in the synthesis of 4-amino-1,5-naphthalenedisulphonate acid monosodium salt, an intermediate employed in the synthesis of modified suramin molecule.
It may be used in the synthesis of the following:
- benzophenone derivative
- substituted 3-amino-4-methyl-N-phenylbenzamide
- retroamide
- 4-methyl-3-nitro-N-phenylbenzamide
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |




