A8562832
(R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-bi-2-naphthol , 98% , 756491-54-0
CAS NO.:756491-54-0
Empirical Formula: C36H18F12O2
Molecular Weight: 710.51
MDL number: MFCD08689862
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB189.60 | In Stock |
|
| 250mg | RMB703.20 | In Stock |
|
| 1g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-220 °C |
| Boiling point: | 574.7±50.0 °C(Predicted) |
| Density | 1.466±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 7.62±0.50(Predicted) |
| form | solid |
| color | White to yellow |
| optical activity | [α]22/D 45°, c = 1 in chloroform |
| InChIKey | PGXMYJSTCAQJBY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(cc(c1)c2cc3c(c(c2O)c4c5c(cc(c4O)c6cc(cc(c6)C(F)(F)F)C(F)(F)F)cccc5)cccc3)C(F)(F)F |
Description and Uses
Precursor to a chiral Bronsted acid (680184) used to catalyze an enantioselective aza Diels-Alder reaction providing bicyclic lactams. Rare earth metal complexes of this chiral binapthol catalyze an intramolecular hydroamination of amino olefins leading to chiral pyrrolidines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![(R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-bi-2-naphthol](https://img.chemicalbook.com/CAS/GIF/756491-54-0.gif)

![(R)-5,5',6,6',7,7',8,8'-Octahydro-3,3'-diphenyl-[1,1'-binaphthalene]-2,2'-diol](https://img.chemicalbook.com/CAS/20150408/GIF/396134-73-9.gif)
![(R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthyl-2,2'-diylHydrogenPhosphate](https://img.chemicalbook.com/CAS/20180808/GIF/1011465-24-9.gif)
![(R)-3,3''-Bis[4-(2-naphthalenyl)phenyl]-[1,1''-binaphthalene]-2,2''-diol](https://img.chemicalbook.com/CAS/20180808/GIF/309934-86-9.gif)

![(R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthyl-2,2'-diylHydrogenPhosphate](https://img.chemicalbook.com/CAS/GIF/791616-62-1.gif)