A8572932
S-Phenyl-L-cysteine , ≥95.0% , 34317-61-8
Synonym(s):
3-(Phenylthio)-L- Alanine;4-Thia-L -homophenylalanine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB132.00 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C (dec.) (lit.) |
| alpha | 10 º (c=1, 0.1N NaOH) |
| Boiling point: | 361.5±37.0 °C(Predicted) |
| Density | 1.2342 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly), Aqueous Base (Slightly) |
| form | Solid |
| pka | 2.04±0.10(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D +10°, c = 1.5 in 1 M NaOH |
| Water Solubility | Water: sparingly soluble |
| BRN | 2268203 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H11NO2S/c10-8(9(11)12)6-13-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | XYUBQWNJDIAEES-QMMMGPOBSA-N |
| SMILES | N[C@@H](CSc1ccccc1)C(O)=O |
| CAS DataBase Reference | 34317-61-8(CAS DataBase Reference) |
Description and Uses
Inhibitor of enzyme.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HS Code | 29309016 |
| Storage Class | 11 - Combustible Solids |




