A9218914
Ether-d<sub>10</sub> , D,99% , 2679-89-2
Synonym(s):
Di(ethyl-d5) ether;Diethyl ether-d10
CAS NO.：2679-89-2
Empirical Formula: C4H10O
Molecular Weight: 74.12
MDL number: MFCD00062316
EINECS: 220-235-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB1119.20 | In Stock |
|
| 5G | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -116 °C(lit.) |
| Boiling point: | 33-34 °C(lit.) |
| Density | 0.801 g/mL at 25 °C |
| refractive index | 1.351-1.353 |
| Flash point: | -40 °F |
| storage temp. | 0-6°C |
| solubility | 69g/l |
| form | Liquid |
| color | Colorless |
| explosive limit | 1.7-36%(V) |
| InChI | 1S/C4H10O/c1-3-5-4-2/h3-4H2,1-2H3/i1D3,2D3,3D2,4D2 |
| InChIKey | RTZKZFJDLAIYFH-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC([2H])([2H])C([2H])([2H])[2H] |
| EPA Substance Registry System | Diethyl ether-d10 (2679-89-2) |
Description and Uses
Ether-d10 (Diethyl ether-d10) may be used as an NMR solvent to propose the structure for [4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,3,3-trimethyl-1-(trimethylsilyl)butyl]lithium based on the NMR data.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H224-H302-H336 |
| Precautionary statements | P210-P233-P240-P241-P301+P312-P403+P233 |
| target organs | Central nervous system |
| Hazard Codes | F+,Xn |
| Risk Statements | 12-19-22-66-67 |
| Safety Statements | 9-16-29-33 |
| RIDADR | UN 1155 3/PG 1 |
| WGK Germany | 1 |
| HazardClass | 3 |
| PackingGroup | I |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 1 STOT SE 3 |
