N1,N3-Bis(2,3-dihydroxypropyl)-5-nitroisophthalamide , 95% , 76820-34-3
Synonym(s):
N,N′-Bis(2,3-dihydroxypropyl)-5-nitro-1,3-benzenedicarboxamide;N,N′-Bis(2,3-dihydroxypropyl)-5-nitroisophthalamide
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB419.20 | In Stock |
|
| 250mg | RMB712.00 | In Stock |
|
| 1g | RMB1920.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | >140°C (dec.) |
| Density | 1.347 at 20℃ |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C14H19N3O8/c18-6-11(20)4-15-13(22)8-1-9(3-10(2-8)17(24)25)14(23)16-5-12(21)7-19/h1-3,11-12,18-21H,4-7H2,(H,15,22)(H,16,23) |
| InChIKey | LJEBHEAPZMNBSI-UHFFFAOYSA-N |
| SMILES | C1(C(NCC(O)CO)=O)=CC([N+]([O-])=O)=CC(C(NCC(O)CO)=O)=C1 |
| LogP | -1.36 at 23℃ and pH6 |
| CAS DataBase Reference | 76820-34-3(CAS DataBase Reference) |
Description and Uses
N,N'-Bis(2,3-dihydroxypropyl)-5-nitro-1,3-benzenedicarboxamide is a non-ionic organic compound that can be used as a reaction intermediate for the preparation of amidated iodinated x-ray contrast media. The amidation reaction is typically carried out in aqueous solution with an acid catalyst at room temperature for up to 24 hours. The amidation reaction condition and time can be optimized depending on the desired end product. Industrial preparation of iohexol typically involves the use of an x-ray generator and iopamidol, which is synthesized from diethylene triamine and ethylenediamine.
N,N'-Bis(2,3-dihydroxypropyl)-5-nitro-1,3-benzenedicarboxamide is used in the preparation of X-ray contrast agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2924296000 |





