BD0035553
2-Benzoyl-4-bromoaniline , 99+% , 39859-36-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB118.40 | In Stock |
|
| 25g | RMB404.00 | In Stock |
|
| 100g | RMB1332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-113℃ |
| Boiling point: | 424.6±35.0 °C(Predicted) |
| Density | 1.484±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml |
| pka | -0.01±0.10(Predicted) |
| form | Powder |
| color | Yellow |
| InChI | InChI=1S/C13H10BrNO/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H,15H2 |
| InChIKey | LXJVUGANBDAASB-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Br)=CC=C1N)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 39859-36-4(CAS DataBase Reference) |
Description and Uses
2-Amino-5-bromobenzophenone is a benzophenone (B204980) derivative that is widely used in the synthesis of pharmaceutical compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2922.39.4500 |
| HazardClass | 6.1 |






