BD0056832
Methyl 5-bromo-1H-indazole-3-carboxylate , 95% , 78155-74-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB30.40 | In Stock |
|
| 250mg | RMB49.60 | In Stock |
|
| 1g | RMB148.80 | In Stock |
|
| 5g | RMB666.40 | In Stock |
|
| 10g | RMB1170.40 | In Stock |
|
| 25g | RMB2288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210℃ |
| Boiling point: | 399.7±22.0 °C(Predicted) |
| Density | 1.709 |
| storage temp. | 2-8°C |
| pka | 10.67±0.40(Predicted) |
| Appearance | off-white solid |
| InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)8-6-4-5(10)2-3-7(6)11-12-8/h2-4H,1H3,(H,11,12) |
| InChIKey | WVNKCZKRGOOMNU-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C(C(OC)=O)=N1 |
Description and Uses
Methyl 5-bromo-1H-indazole-3-carboxylate is an indole azole compound containing a five-membered heteroaromatic ring structure and can be used in organic synthesis. Its derivatives can also be used to treat or prevent herpes virus infection in patients.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P271-P260-P280 |
| HS Code | 2933998090 |
