BD0063432
tert-Butyl 4-bromobenzoate , 97% , 59247-47-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB150.40 | In Stock |
|
| 10g | RMB278.40 | In Stock |
|
| 25g | RMB604.00 | In Stock |
|
| 100g | RMB2274.40 | In Stock |
|
| 500g | RMB6912.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 91-92 °C(Press: 1.2 Torr) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | liquid |
| color | Colourless to light yellow |
| InChI | InChI=1S/C11H13BrO2/c1-11(2,3)14-10(13)8-4-6-9(12)7-5-8/h4-7H,1-3H3 |
| InChIKey | BFJJYXUCGYOXDM-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)C1=CC=C(Br)C=C1 |
Description and Uses
4-bromo substituted benzoic acid derivative, tert-Butyl-4-broMobenzoate can be used as a building block for the synthesis of various biologically active compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2916399090 |
