BD0069332
(S)-Morpholine-3-carboxylic acid hydrochloride , 97% , 1187929-04-9
CAS NO.：1187929-04-9
Empirical Formula: C5H10ClNO3
Molecular Weight: 167.591
MDL number: MFCD06809590
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB69.60 | In Stock |
|
| 1g | RMB204.00 | In Stock |
|
| 5g | RMB726.40 | In Stock |
|
| 10g | RMB1402.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| InChI | InChI=1/C5H9NO3.ClH/c7-5(8)4-3-9-2-1-6-4;/h4,6H,1-3H2,(H,7,8);1H/t4-;/s3 |
| InChIKey | CWSLARZELUGARZ-NDILARRWNA-N |
| SMILES | C([C@H]1NCCOC1)(=O)O.Cl |&1:1,r| |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2934999090 |
