BD0075048
2,3-Dibromophenol , 98% , 57383-80-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB167.20 | In Stock |
|
| 250mg | RMB285.60 | In Stock |
|
| 1g | RMB701.60 | In Stock |
|
| 5g | RMB2143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-69 °C |
| Boiling point: | 252.1±20.0 °C(Predicted) |
| Density | 2.095±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.47±0.10(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C6H4Br2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| InChIKey | FNAKEOXYWBWIRT-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(Br)=C1Br |
Description and Uses
Fundamental starting material for organic synthesis.Metabolite of dibromobenzene in urine of rabbit.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P305+P351+P338 |
