S0435916
Pentabromophenyl methacrylate , 96% , 18967-31-2
Synonym(s):
2,3,4,5,6-Pentafluorostyrene polymer;Poly(2,3,4,5,6-pentafluorostyrene)
CAS NO.:18967-31-2
Empirical Formula: C10H5Br5O2
Molecular Weight: 556.67
MDL number: MFCD00080605
EINECS: 242-705-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2324.82 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141 °C (lit.) |
| Boiling point: | 477.7±45.0 °C(Predicted) |
| Density | 2.359±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| InChI | 1S/C10H5Br5O2/c1-3(2)10(16)17-9-7(14)5(12)4(11)6(13)8(9)15/h1H2,2H3 |
| InChIKey | OFZRSOGEOFHZKS-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)Oc1c(Br)c(Br)c(Br)c(Br)c1Br |
Description and Uses
Monomer used to make high refractive index polymer for optical waveguides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-28 |
| WGK Germany | 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







