A3771112
2,5-Dibromophenol , 98% , 28165-52-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1G | RMB76.00 | In Stock |
|
| 5G | RMB275.20 | In Stock |
|
| 25g | RMB1072.80 | In Stock |
|
| 100g | RMB15199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-74 °C |
| Boiling point: | 244.6±20.0 °C(Predicted) |
| Density | 2.095±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 7.47±0.10(Predicted) |
| form | powder |
| color | White |
| InChI | InChI=1S/C6H4Br2O/c7-4-1-2-5(8)6(9)3-4/h1-3,9H |
| InChIKey | GUXWVUVLXIJHQF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Br)=CC=C1Br |
Description and Uses
2,5-Dibromophenol is an important intermediate in organic synthesis and is often used to synthesize other complex organic molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2908190090 |
