S6241551
96% , 52660-82-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB4283.78 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-151 °C (lit.) |
| Boiling point: | 469.4±45.0 °C(Predicted) |
| Density | 2.471±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | solid |
| InChI | 1S/C9H3Br5O2/c1-2-3(15)16-9-7(13)5(11)4(10)6(12)8(9)14/h2H,1H2 |
| InChIKey | BKKVYNMMVYEBGR-UHFFFAOYSA-N |
| SMILES | Brc1c(Br)c(Br)c(OC(=O)C=C)c(Br)c1Br |
Description and Uses
Pentabromophenyl acrylate can form copolymers with acrylonitrile in aqueous emulsions or in the presence of a free radical initiator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H317-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
