BD0082932
4-Amino-1-isopropylpiperidine , 97% , 127285-08-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB73.60 | In Stock |
|
| 5g | RMB260.00 | In Stock |
|
| 25g | RMB1072.00 | In Stock |
|
| 100g | RMB3817.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 173.2±8.0 °C(Predicted) |
| Density | 0.904±0.06 g/cm3(Predicted) |
| refractive index | 1.4720 to 1.4760 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | 10.51±0.20(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C8H18N2/c1-7(2)10-5-3-8(9)4-6-10/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | ZRQQXFMGYSOKDF-UHFFFAOYSA-N |
| SMILES | N1(C(C)C)CCC(N)CC1 |
| CAS DataBase Reference | 127285-08-9(CAS DataBase Reference) |
Description and Uses
1-Isopropylpiperidin-4-amine is used as a pharmaceutical intermediate compound for the preparation of antiviral compounds or small molecule bioactive inhibitors.
Safety
| Symbol(GHS) |   GHS05,GHS02 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P280-P210-P309+P311 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2920 8/3/PG II |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 2933399990 |
