BD0098732
4-(4-(tert-Butoxycarbonyl)piperazin-1-yl)benzoic acid , 95% , 162046-66-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB58.40 | In Stock |
|
| 5g | RMB216.80 | In Stock |
|
| 10g | RMB417.60 | In Stock |
|
| 25g | RMB744.00 | In Stock |
|
| 100g | RMB2256.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50 °C |
| Boiling point: | 476.9±40.0 °C(Predicted) |
| Density | 1.213±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 5.12±0.10(Predicted) |
| color | Off-white |
| InChI | 1S/C16H22N2O4/c1-16(2,3)22-15(21)18-10-8-17(9-11-18)13-6-4-12(5-7-13)14(19)20/h4-7H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | BEDWYXZFIYMEJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)c2ccc(cc2)C(O)=O |
| CAS DataBase Reference | 162046-66-4(CAS DataBase Reference) |
Description and Uses
Boc-piperazine-benzoic acid is a PROTAC linker and can be used in the synthesis of PROTACs, such as PROTAC androgen receptor (AR) degrader ARD-2128 (HY-13229)[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-26-36/37/39 |
| Hazard Note | Harmful |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
