LN3378349
Levodropropizine , ≥98% , 99291-24-4
Synonym(s):
(2S)-3-(4-Phenyl-1-piperazinyl)-1,2-propanediol
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB640.00 | In Stock |
|
| 100mg | RMB856.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100° |
| alpha | D25 -10° (c = 1.0 in ethanol) |
| Boiling point: | 412.7±34.0 °C(Predicted) |
| Density | 1.168±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Methanol (Slightly) |
| pka | 14.21±0.20(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C13H20N2O2/c16-11-13(17)10-14-6-8-15(9-7-14)12-4-2-1-3-5-12/h1-5,13,16-17H,6-11H2/t13-/m1/s1 |
| InChIKey | PTVWPYVOOKLBCG-CYBMUJFWSA-N |
| SMILES | N1(CCN(CC1)c2ccccc2)C[C@@H](O)CO |
| CAS DataBase Reference | 99291-24-4(CAS DataBase Reference) |
Description and Uses
Levodropropizine is an antitussive with antiinflammatory activity, the L-isomer of dropropizine. Compared with the racemate, levodropropizine is reported to have less sedative potential and better therapeutic index, while maintaining the the same efficacy levels as an antitussive and antiinflammatory.
R-Form of Dropropizine (D681495). (R)-(+)-Dropropizine is a cough suppressive phenylpiperazine derivative. (R)-(+)-Dropropizine is an antitussive and central sedative therapeutic agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in mice, rats (mg/kg): 1287.2, 886.6 orally; 408.0, 401.3 i.p. (Borsa) |
