BD0102656
(4-Chlorophenyl)(4-(8-nitroquinolin-5-yl)piperazin-1-yl)methanone , 97% , 115687-05-3
Synonym(s):
5-[4-(4-Chlorobenzoyl)-1-piperazinyl]-8-nitroquinoline;B2
CAS NO.：115687-05-3
Empirical Formula: C20H17ClN4O3
Molecular Weight: 396.83
MDL number: MFCD02039810
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB668.80 | In Stock |
|
| 100mg | RMB1002.40 | In Stock |
|
| 250mg | RMB1703.20 | In Stock |
|
| 1g | RMB4428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-176°C |
| Boiling point: | 645.5±55.0 °C(Predicted) |
| Density | 1.412±0.06 g/cm3(Predicted) |
| storage temp. | Store at +4°C |
| solubility | H2O: insoluble <2mg/mL |
| pka | 2.30±0.29(Predicted) |
| form | solid |
| color | brown |
| Water Solubility | H2O: insoluble <2mg/mL DMSO: >5mg/mL |
| InChI | 1S/C20H17ClN4O3/c21-15-5-3-14(4-6-15)20(26)24-12-10-23(11-13-24)17-7-8-18(25(27)28)19-16(17)2-1-9-22-19/h1-9H,10-13H2 |
| InChIKey | KLNPVNZJCWIQSK-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(N2CCN(CC2)C(=O)c3ccc(Cl)cc3)c4cccnc14 |
Description and Uses
B2 is a cell permeable inhibitor of SIRT2 (sirtuin 2). Multidrug resistance protein 4 (MRP4) inhibitor in tumors such as neuroblastoma and colorectal cancer.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
