BD0124648
4-Ethyl-2,3-dioxopiperazine-1-carbonylchloride , 95% , 59703-00-3
CAS NO.：59703-00-3
Empirical Formula: C7H9ClN2O3
Molecular Weight: 204.61
MDL number: MFCD00067054
EINECS: 261-867-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB60.80 | In Stock |
|
| 25g | RMB194.40 | In Stock |
|
| 100g | RMB616.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100 °C |
| Boiling point: | 292.9±23.0 °C(Predicted) |
| Density | 1.408±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Soluble), DMSO (Slightly) |
| form | powder |
| pka | -1.81±0.20(Predicted) |
| color | White |
| Water Solubility | decomposes |
| Stability: | Moisture Sensitive |
| InChI | 1S/C7H9ClN2O3/c1-2-9-3-4-10(7(8)13)6(12)5(9)11/h2-4H2,1H3 |
| InChIKey | SXVBQOZRZIUHKU-UHFFFAOYSA-N |
| SMILES | CCN1CCN(C(Cl)=O)C(=O)C1=O |
| LogP | -1.48 |
| CAS DataBase Reference | 59703-00-3(CAS DataBase Reference) |
Description and Uses
4-Ethyl-2,3-dioxo-1-piperazinecarbonyl Chloride is used as a reagent in the synthesis of amino(thienyl)benzamide derivatives which are used as histone deacetylase inhibitors and have antitumor activity. 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl Chloride is also a reagent in the synthesis of Cefbuperazone (C242540); a second-generation cephalosporin antibiotic.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 45-36/37/39-26 |
| WGK Germany | WGK 3 |
| HS Code | 2933599590 |
| Storage Class | 13 - Non Combustible Solids |
