BD0128832
Isoquinolin-8-amine , 98% , 23687-27-6
CAS NO.:23687-27-6
Empirical Formula: C9H8N2
Molecular Weight: 144.17
MDL number: MFCD00179553
EINECS: 691-616-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB28.80 | In Stock |
|
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB132.80 | In Stock |
|
| 5g | RMB573.60 | In Stock |
|
| 10g | RMB1032.80 | In Stock |
|
| 25g | RMB2107.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-157 |
| Boiling point: | 335.7±17.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| pka | 6.20±0.23(Predicted) |
| form | Crystalline Powder |
| color | Brown |
| InChI | InChI=1S/C9H8N2/c10-9-3-1-2-7-4-5-11-6-8(7)9/h1-6H,10H2 |
| InChIKey | GUSYANXQYUJOBH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2N)C=CN=1 |
| CAS DataBase Reference | 23687-27-6(CAS DataBase Reference) |
Description and Uses
8-Aminoisoquinoline and its derivatives are used as intermediates for antimalarial drugs in the pharmaceutical field. For example, their structure is similar to the antimalarial drug primaquine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







