PRODUCT Properties
| Melting point: | 122-124 °C (lit.) |
| Boiling point: | 166°C/8mmHg(lit.) |
| Density | 1.1148 (estimate) |
| refractive index | 1.7080 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | pK1: 7.62(+1) (20°C,μ=0.01) |
| color | Light yellow to Brown to Dark green |
| λmax | 335nm(H2O)(lit.) |
| InChI | InChI=1S/C9H8N2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6H,(H2,10,11) |
| InChIKey | OSILBMSORKFRTB-UHFFFAOYSA-N |
| SMILES | C1(N)C2=C(C=CC=C2)C=CN=1 |
| CAS DataBase Reference | 1532-84-9(CAS DataBase Reference) |
Description and Uses
1-Aminoisoquinoline was used in the synthesis of pyrimidoisoquinolinone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
