BD0139032
Ethyl 3-(4-chlorophenyl)-3-oxo-propionate , 97% , 2881-63-2
Synonym(s):
3-(4-Chlorophenyl)-3-oxopropanoic acid ethyl ester;Ethyl 3-(4-chlorophenyl)-3-oxopropanoate;NSC 406743
| Pack Size | Price | Stock | Quantity |
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB239.20 | In Stock |
|
| 10g | RMB460.00 | In Stock |
|
| 25g | RMB1034.40 | In Stock |
|
| 100g | RMB3641.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38 °C(Solv: ethanol (64-17-5)) |
| Boiling point: | 268-269 °C(lit.) |
| Density | 1.218 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Acetone |
| form | powder to lump |
| pka | 9.56±0.25(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C11H11ClO3/c1-2-15-11(14)7-10(13)8-3-5-9(12)6-4-8/h3-6H,2,7H2,1H3 |
| InChIKey | DGCZHKABHPDNCC-UHFFFAOYSA-N |
| SMILES | C1(C=CC(Cl)=CC=1)C(=O)CC(=O)OCC |
| CAS DataBase Reference | 2881-63-2(CAS DataBase Reference) |
Description and Uses
Ethyl (4-chlorobenzoyl)acetate may be used to synthesize 2-(carboethoxy)-3-(4′-chloro)phenylquinoxaline 1,4-dioxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H319-H335-H332-H302-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| WGK Germany | 3 |
| HS Code | 2918300090 |






