PRODUCT Properties
| Melting point: | 221-222℃ |
| alpha | D18 -80° (c = 10 in pyridine) |
| Boiling point: | 422.63°C (rough estimate) |
| Density | 1.588 |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: 1mg/mL |
| form | Solid |
| pka | 12.73±0.70(Predicted) |
| color | White to off-white |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C15H16O8/c16-6-10-12(18)13(19)14(20)15(23-10)21-8-3-1-7-2-4-11(17)22-9(7)5-8/h1-5,10,12-16,18-20H,6H2/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | VPAOSFFTKWUGAD-TVKJYDDYSA-N |
| SMILES | O[C@H]1[C@@H](O[C@@H]([C@H]([C@@H]1O)O)CO)OC2=CC(O3)=C(C=C2)C=CC3=O |
Description and Uses
Skimmin is a useful research chemical with neuroprotective effects.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
