BD0158153
Methyl2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetatesulfate , 98% , 135046-48-9
Synonym(s):
(+/-)-Clopidogrel Hydrogensulfate - CAS 135046-48-9 - Calbiochem;Methyl (2-chlorophenyl)(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate hydrogen sulfate;Purinergic P2Y12 Receptor Antagonist, (+/-)-Clopidogrel, Plavix;SR-25990
CAS NO.:135046-48-9
Empirical Formula: C16H16ClNO2S.H2O4S
Molecular Weight: 419.9
MDL number: MFCD00876395
EINECS: 603-890-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB94.40 | In Stock |
|
| 250mg | RMB160.00 | In Stock |
|
| 1g | RMB414.40 | In Stock |
|
| 5g | RMB1653.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184°C |
| alpha | D20 +55.10° (c = 1.891 in methanol) |
| storage temp. | 2-8°C |
| solubility | DMSO: ~26mg/mL |
| form | White powder |
| color | white |
| InChI | InChI=1S/C16H16ClNO2S.H2O4S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-5(2,3)4/h2-5,7,9,15H,6,8,10H2,1H3;(H2,1,2,3,4) |
| InChIKey | FDEODCTUSIWGLK-RSAXXLAASA-N |
| SMILES | S(O)(O)(=O)=O.C(C1C=CC=CC=1Cl)(N1CCC2SC=CC=2C1)C(=O)OC |
| CAS DataBase Reference | 135046-48-9(CAS DataBase Reference) |
Description and Uses
rac-Clopidogrel Hydrogen Sulfate is used in the synthesis of Clopidogrel derivatives as platelet aggregation inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H411 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B |

![Methyl2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetatesulfate](https://img.chemicalbook.com/CAS/GIF/135046-48-9.gif)





