BD0165353
2-Bromo-2-chloroaceticacid , 95% , 5589-96-8
CAS NO.:5589-96-8
Empirical Formula: C2H2BrClO2
Molecular Weight: 173.39
MDL number: MFCD00143872
EINECS: 627-754-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB208.00 | In Stock |
|
| 1g | RMB422.40 | In Stock |
|
| 5g | RMB1372.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27.5 °C(lit.) |
| Boiling point: | 210-212 °C767 mm Hg(lit.) |
| Density | 1.985 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| pka | 1.39±0.10(Predicted) |
| BRN | 1720556 |
| InChI | InChI=1S/C2H2BrClO2/c3-1(4)2(5)6/h1H,(H,5,6) |
| InChIKey | GEHJBWKLJVFKPS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(Br)Cl |
| CAS DataBase Reference | 5589-96-8 |
| IARC | 2B (Vol. 101) 2013 |
| EPA Substance Registry System | Bromochloroacetic acid (5589-96-8) |
Description and Uses
Bromochloroacetic acid is a halogenated disinfection byproduct commonly found in drinking water, fruit juice, and cheese. Bromochloroacetic acid has been shown to cause mesothelioma, fibroadenomas, and adenomas in rats
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi,F |
| Risk Statements | 34-40-36/37/38-38-11 |
| Safety Statements | 26-27-36/37/39-45-36-16-24-9 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | AF5957282 |
| F | 19 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 5589-96-8(Hazardous Substances Data) |






