BD0166253
trans-Cyclopentane-1,2-diol , 98% , 5057-99-8
CAS NO.：5057-99-8
Empirical Formula: C5H10O2
Molecular Weight: 102.13
MDL number: MFCD00082582
EINECS: 225-757-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.80 | In Stock |
|
| 1g | RMB73.60 | In Stock |
|
| 5g | RMB363.20 | In Stock |
|
| 25g | RMB1795.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-56 °C(lit.) |
| Boiling point: | 136 °C21.5 mm Hg(lit.) |
| Density | 1.235 |
| refractive index | 1. |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | gel/ oil |
| pka | 14.48±0.40(Predicted) |
| color | Light yellow |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1/C5H10O2/c6-4-2-1-3-5(4)7/h4-7H,1-3H2/t4-,5-/s3 |
| InChIKey | VCVOSERVUCJNPR-RFZPGFLSSA-N |
| SMILES | [C@@H]1(O)CCC[C@H]1O |&1:0,5,r| |
| CAS DataBase Reference | 5057-99-8 |
Description and Uses
(1R,2R)-rel-trans-1,2-Cyclopentanediol is a building block for the synthesis of chiral phosphine ligands. It can also be used to prepare benzoquinolines and benzoindoles via heterocyclization of naphthylamines with diols catalyzed by iridium chloride/BINAP.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-4.3-10 |
| HS Code | 2906190090 |
