BD4990041
trans-Cyclobutane-1,2-dicarboxylicacid , 97% , 1124-13-6
CAS NO.:1124-13-6
Empirical Formula: C6H8O4
Molecular Weight: 144.13
MDL number: MFCD00068260
EINECS: 214-392-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1g | RMB77.60 | In Stock |
|
| 5g | RMB272.80 | In Stock |
|
| 25g | RMB925.60 | In Stock |
|
| 100g | RMB3223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-131 °C |
| Boiling point: | 140 °C(Press: 2 Torr) |
| Density | 1.509±0.06 g/cm3(Predicted) |
| refractive index | 1.4556 (589.3 nm 25℃) |
| storage temp. | 2-8°C |
| form | solid |
| pka | pK1:3.79 ;pK2:5.61 (25°C) |
| Appearance | Light yellow to yellow Solid |
| BRN | 3198993 |
| InChI | InChI=1/C6H8O4/c7-5(8)3-1-2-4(3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)/t3-,4-/s3 |
| InChIKey | SUSAGCZZQKACKE-QWWZWVQMSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@H]1C(O)=O |&1:0,6,r| |
Description and Uses
The interaction of the carboxyl groups in the fragmentation of the molecular ions of cis-cyclobutane-1,2-dicarboxylic acid helps to distinguish it from trans-cyclobutane-1,2-dicarboxylic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | GU1680000 |
| HS Code | 2917200090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







