BD7904031
Dimethyl trans-1,4-Cyclohexanedicarboxylate , 96% , 3399-22-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB80.00 | In Stock |
|
| 10g | RMB121.60 | In Stock |
|
| 25g | RMB203.20 | In Stock |
|
| 100g | RMB664.80 | In Stock |
|
| 500g | RMB3253.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-69 °C(lit.) |
| Boiling point: | 263.5±0.0℃ (760 Torr) |
| Density | 1.102±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.4560 (589.3 nm 31℃) |
| Flash point: | 115.4±18.8℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | White to faintly yellow |
| BRN | 2213375 |
| InChI | InChI=1S/C10H16O4/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2/h7-8H,3-6H2,1-2H3/t7-,8- |
| InChIKey | LNGAGQAGYITKCW-ZKCHVHJHSA-N |
| SMILES | [C@@H]1(C(OC)=O)CC[C@@H](C(OC)=O)CC1 |
| EPA Substance Registry System | 1,4-Cyclohexanedicarboxylic acid, dimethyl ester, trans- (3399-22-2) |
Description and Uses
Dimethyl trans-cyclohexane-1,4-dicarboxylate is an unsaturated ester. Sterically favored conformations of the dimethyl trans-cyclohexane-1,4-dicarboxylate molecule has been reported.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H320 |
| Precautionary statements | P264-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 52/53-38 |
| Safety Statements | 22-24/25-61-37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29172090 |
| Storage Class | 13 - Non Combustible Solids |







