BD0169853
Di-tert-butylphosphonate , 95% , 13086-84-5
Synonym(s):
Di-tert-butyl phosphonate
CAS NO.:13086-84-5
Empirical Formula: C8H19O3P
Molecular Weight: 194.21
MDL number: MFCD00014999
EINECS: 235-996-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB68.00 | In Stock |
|
| 5g | RMB178.40 | In Stock |
|
| 25g | RMB746.40 | In Stock |
|
| 100g | RMB2766.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >235 °C (decomp)(Solv: hexane (110-54-3)) |
| Boiling point: | Value: 62-62.5 °C | Condition: Press: 4 Torr |
| Density | 0.995 |
| refractive index | 1.4200 |
| Flash point: | 66-68°C/0.5mm |
| storage temp. | 2-8°C |
| solubility | Soluble in organic solvents |
| form | Liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.995 |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/C8H19O3P/c1-7(2,3)10-12(9)11-8(4,5)6/h12H,1-6H3 |
| InChIKey | RRJHOMPUEYYASJ-UHFFFAOYSA-N |
| SMILES | P(=O)(OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 13086-84-5 |
Description and Uses
Di-tert-butyl phosphite is used as a solvent, as an antioxidant, and as an intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H317 |
| Precautionary statements | P261-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8 / PGIII |
| WGK Germany | 3 |
| PackingGroup | III |
| HS Code | 29209090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B Skin Sens. 1B |








