BD0177332
tert-Butyl (5-bromothiazol-2-yl)carbamate , 97% , 405939-39-1
CAS NO.：405939-39-1
Empirical Formula: C8H11BrN2O2S
Molecular Weight: 279.15
MDL number: MFCD07368614
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 1g | RMB54.40 | In Stock |
|
| 5g | RMB218.40 | In Stock |
|
| 10g | RMB355.20 | In Stock |
|
| 25g | RMB746.40 | In Stock |
|
| 100g | RMB2472.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149 °C |
| Density | 1.574±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.58±0.70(Predicted) |
| form | Solid |
| Appearance | Off-white to yellow Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H11BrN2O2S/c1-8(2,3)13-7(12)11-6-10-4-5(9)14-6/h4H,1-3H3,(H,10,11,12) |
| InChIKey | OIBKBVFFZYCBAQ-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1=NC=C(Br)S1 |
Description and Uses
N-Boc-2-amino-5-bromothiazole is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2933399990 |
