BD0199732
tert-Butyl 3-(methylamino)azetidine-1-carboxylate , 97% , 454703-20-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB88.80 | In Stock |
|
| 5g | RMB270.40 | In Stock |
|
| 10g | RMB459.20 | In Stock |
|
| 25g | RMB924.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 249℃ |
| Density | 1.04 |
| Flash point: | 105℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.23±0.20(Predicted) |
| form | liquid |
| color | Colourless |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-5-7(6-11)10-4/h7,10H,5-6H2,1-4H3 |
| InChIKey | CHRBSEYIEDTNSC-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(NC)C1 |
| CAS DataBase Reference | 454703-20-9 |
Description and Uses
1-Boc-3-(methylamino)azetidine is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T,N |
| Risk Statements | 25-50 |
| Safety Statements | 45-61 |
| RIDADR | 2810 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




![Tert-butyl3-((1-(4-fluorobenzyl)-1H-benzo[d]imidazol-2-yl)amino)azetidine-1-carboxylate](https://img.chemicalbook.com/CAS/GIF/885276-28-8.gif)

