PRODUCT Properties
| Melting point: | 20.5°C |
| Boiling point: | 122 °C / 12mmHg |
| Density | 1,03 g/cm3 |
| refractive index | 1.5600-1.5640 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| color | White to Yellow to Green |
| InChI | InChI=1S/C10H10O/c1-2-6-10(11)9-7-4-3-5-8-9/h2-8H,1H3 |
| InChIKey | FUJZJBCWPIOHHN-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)C=CC |
| CAS DataBase Reference | 495-41-0 |
| EPA Substance Registry System | Crotonophenone (495-41-0) |
Description and Uses
1-Phenyl-2-buten-1-one is used in the preparation of chalcones derivatives and analogs and for the testing of their antimicrobial activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HS Code | 2914390090 |
