BD0213753
1-(2,2-Dimethyl-2H-chromen-6-yl)ethanone , 95% , 19013-07-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB175.20 | In Stock |
|
| 250mg | RMB293.60 | In Stock |
|
| 1g | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 329.8±42.0 °C(Predicted) |
| Density | 1.061±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| form | Off-white to yellowish solid. |
| color | Yellow to brown |
| InChI | InChI=1S/C13H14O2/c1-9(14)10-4-5-12-11(8-10)6-7-13(2,3)15-12/h4-8H,1-3H3 |
| InChIKey | ZAJTXVHECZCXLH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C=C2C(=CC=1)OC(C)(C)C=C2)C |
Description and Uses
Demethoxyencecalin is a chromene isolated from Helianthus annuus, has antifungal activities[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
