PRODUCT Properties
| Melting point: | 69-70 °C |
| Boiling point: | 130-135 °C(Press: 1 Torr) |
| Density | 1.184±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H10O3/c1-7-8-5-3-4-6-9(8)14-10(7)11(12)13-2/h3-6H,1-2H3 |
| InChIKey | HVUOTQOUAMXGLR-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C(C)=C1C(OC)=O |
Description and Uses
3-Methylbenzofuran-2-carboxylic Acid Methyl Ester acts as a reagent in the synthesis and SAR of highly selective MMP-13 Inhibitors, preparation of saframycin analogs for the treatment of cancer.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351-H361 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2932990090 |
