BD0253053
N-Boc-L-CysteineMethylester , 90% , 55757-46-5
Synonym(s):
N-Boc-L -cysteine methyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB51.20 | In Stock |
|
| 5g | RMB164.00 | In Stock |
|
| 25g | RMB531.20 | In Stock |
|
| 100g | RMB1753.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 214 °C(lit.) |
| Density | 1.143 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.475(lit.) |
| Flash point: | 113 °C |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 9.29±0.10(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]22/D +21°, c = 7.5 in chloroform |
| InChI | InChI=1S/C9H17NO4S/c1-9(2,3)14-8(12)10-6(5-15)7(11)13-4/h6,15H,5H2,1-4H3,(H,10,12)/t6-/m0/s1 |
| InChIKey | NJGIAKIPSDCYAC-LURJTMIESA-N |
| SMILES | C(OC)(=O)[C@H](CS)NC(OC(C)(C)C)=O |
Description and Uses
N-(tert-Butoxycarbonyl)-L-cysteine methyl ester is a research chemical compound used in the preparation of terminal alkenes and allyl sulfides and preparation of trifluoromethyl substituted compounds.
Safety
| WGK Germany | 3 |
