BD0258653
4-Methylumbelliferylphosphate , 98% , 3368-04-5
Synonym(s):
4-methylumbelliferone phosphate Liquid Substrate System;4-Methylumbelliferyl-phosphoric acid
CAS NO.:3368-04-5
Empirical Formula: C10H9O6P
Molecular Weight: 256.15
MDL number: MFCD00016969
EINECS: 222-137-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB143.20 | In Stock |
|
| 250mg | RMB345.60 | In Stock |
|
| 1g | RMB964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-218 °C |
| Boiling point: | 511.4±60.0 °C(Predicted) |
| Density | 1.583±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMF: 10 mg/ml; DMSO: 20 mg/ml; PBS (pH 7.2): 5 mg/ml |
| form | liquid |
| pka | 1.65±0.10(Predicted) |
| color | White to Off-white |
| PH | pH (5g/l, 25℃) : 1.5~2.3 |
| Water Solubility | Soluble in water |
| BRN | 1687229 |
| InChI | InChI=1S/C10H9O6P/c1-6-4-10(11)15-9-5-7(2-3-8(6)9)16-17(12,13)14/h2-5H,1H3,(H2,12,13,14) |
| InChIKey | BCHIXGBGRHLSBE-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(OP(O)(O)=O)=CC=C2C(C)=C1 |
| CAS DataBase Reference | 3368-04-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 4-methyl-7-(phosphonooxy)- (3368-04-5) |
Description and Uses
4-Methylumbelliferyl phosphate has been used as a substrate for alkaline phosphatase in the peptide-binding assay. It has also been used as a fluorogenic substrate in enzyme-linked immunosorbent assay (ELISA).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 36-24/25 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29199000 |






