BD0292653
(+)-Trans-limonene1,2-epoxide , 98% , 6909-30-4
Synonym(s):
(+)-trans-p-Mentha-1,8-diene 1,2-epoxide;(1R,4S,6S)-4-isopropenyl-1-methyl-7-oxabicyclo[4.1.0]heptane;(1S,2R,4R)-4-Isopropenyl-1-methyl-1-cyclohexene 1,2-epoxide;(1S,4R)-1,2-Epoxy-p-menth-8-ene
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB646.40 | In Stock |
|
| 250mg | RMB904.00 | In Stock |
|
| 1g | RMB2077.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 198.1±9.0 °C(Predicted) |
| Density | 0.930 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 65 °C |
| storage temp. | 2-8°C |
| form | liquid |
| Odor | at 100.00?%. green |
| optical activity | [α]20/D +90±2°, neat |
| BRN | 80940 |
| Major Application | food and beverages |
| InChI | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9-,10+/m1/s1 |
| InChIKey | CCEFMUBVSUDRLG-BBBLOLIVSA-N |
| SMILES | CC([C@@H]1CC[C@@]2(C)[C@@](O2)([H])C1)=C |
| LogP | 3.200 (est) |
Description and Uses
(+)?-?trans-?Limonene Oxide is a reagent used in the preparation of P-stereogenic secondary phosphine oxides. Also used in the synthesis of novel hydroxyurethanes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H227 |
| Precautionary statements | P210-P264-P270-P280-P301+P312-P330-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 10 - Combustible liquids |




![1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane](https://img.chemicalbook.com/CAS/GIF/1195-92-2.gif)

