BD0296153
N,N-Diethyl-2-methoxy-N-methylethanaminiumbis((trifluoromethyl)sulfonyl)amide , 95% , 464927-84-2
Synonym(s):
N,N-Diethyl-N-methyl-N-(2-methoxyethyl)ammonium bis(trifluoromethanesulfonyl)imide
CAS NO.:464927-84-2
Empirical Formula: C8H20NO.C2F6NO4S2
Molecular Weight: 426.397
MDL number: MFCD06656282
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB206.40 | In Stock |
|
| 250mg | RMB329.60 | In Stock |
|
| 1g | RMB856.80 | In Stock |
|
| 5g | RMB2997.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -91 °C |
| Density | 1.42 g/cm3(Temp: 25 °C) |
| form | liquid |
| BRN | 10134444 |
| InChI | InChI=1S/C8H20NO.C2F6NO4S2/c1-5-9(3,6-2)7-8-10-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | WUFQNPMBKMKEHN-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F.[N+](C)(CC)(CC)CCOC |
Description and Uses
Diethylmethyl(2-methoxyethyl)ammonium bis(trifluoromethylsulfonyl)imide can be used to develop a polymeric gel electrolyte system that shows magnesium ion (Mg2+) mobility.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |





