BD0296253
1-(tert-Butyl)-3-(2,6-diisopropyl-4-phenoxyphenyl)urea , 97% , 136337-67-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB216.80 | In Stock |
|
| 250mg | RMB352.00 | In Stock |
|
| 1g | RMB879.20 | In Stock |
|
| 5g | RMB3077.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | approximate 177℃ (dec.) |
| Boiling point: | 437.8±45.0 °C(Predicted) |
| Density | 1.047±0.06 g/cm3(Predicted) |
| pka | 14.14±0.46(Predicted) |
| InChI | InChI=1S/C23H32N2O2/c1-15(2)19-13-18(27-17-11-9-8-10-12-17)14-20(16(3)4)21(19)24-22(26)25-23(5,6)7/h8-16H,1-7H3,(H2,24,25,26) |
| InChIKey | WLIVADBOJWNAPY-UHFFFAOYSA-N |
| SMILES | N(C1=C(C(C)C)C=C(OC2=CC=CC=C2)C=C1C(C)C)C(NC(C)(C)C)=O |
Description and Uses
[1-tert-Butyl-3-(2,6-diisopropyl-4-phenoxyphenyl) Urea is used in the preparation of Diafenthiuron(D310550) which is an insecticide.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H411-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| HS Code | 2924297099 |
