Propargyl-peg6-acid , 95% , 1951438-84-8
Synonym(s):
4,7,10,13,16,19-Hexaoxadocos-21-ynoic acid;Propargyl-PEG6-CH2CO2H
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB679.20 | In Stock |
|
| 250mg | RMB1013.60 | In Stock |
|
| 1g | RMB2544.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 462.8±45.0 °C(Predicted) |
| Density | 1.126±0.06 g/cm3(Predicted) |
| refractive index | n/D 1.469 |
| storage temp. | -20°C |
| solubility | Soluble in Water |
| form | liquid |
| pka | 4.28±0.10(Predicted) |
| color | Colorless to light yellow |
| InChI | 1S/C16H28O8/c1-2-4-19-6-8-21-10-12-23-14-15-24-13-11-22-9-7-20-5-3-16(17)18/h1H,3-15H2,(H,17,18) |
| InChIKey | XRSJYQQOJNYUDV-UHFFFAOYSA-N |
| SMILES | OC(CCOCCOCCOCCOCCOCCOCC#C)=O |
Description and Uses
Propargyl-PEG6-acid comprises propargyl and carboxylic acid functional groups. The acid group reacts with primary amines in the presence of activators (e.g. EDC, or HATU).The propargyl group reacts with azide-bearing compounds or biomolecules via copper catalyzed azide-alkyne Click Chemistry to yield a stable triazole linkage. The molecule has good solubility in aqueous environment.
This heterobifunctional, PEGylated crosslinker features a carboxylic acid at one end and propargyl group at the other for reaction with azide-containing compounds using click chemistry. The hydrophillic PEG linker facilitates solubility in biological applications. Propargyl-PEG6-acid can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or proteolysis-targeting chimeras (PROTAC molecules) for targeted protein degradation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| WGK Germany | WGK 3 |
| Storage Class | 10 - Combustible liquids |







