BD0328853
4-(Pentyloxy)benzaldehyde , 98% , 5736-91-4
CAS NO.：5736-91-4
Empirical Formula: C12H16O2
Molecular Weight: 192.25
MDL number: MFCD00014135
EINECS: 227-250-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB54.40 | In Stock |
|
| 25g | RMB175.20 | In Stock |
|
| 100g | RMB664.80 | In Stock |
|
| 500g | RMB3168.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 144-147°C 1mm |
| Density | 1,019 g/cm3 |
| Flash point: | 144-147°C/1mm |
| refractive index | 1.5340 |
| storage temp. | 2-8°C, stored under nitrogen |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.019 |
| Sensitive | Air Sensitive |
| BRN | 642040 |
| InChI | InChI=1S/C12H16O2/c1-2-3-4-9-14-12-7-5-11(10-13)6-8-12/h5-8,10H,2-4,9H2,1H3 |
| InChIKey | YAPVGSXODFOBBR-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OCCCCC)C=C1 |
| CAS DataBase Reference | 5736-91-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 4-(pentyloxy)- (5736-91-4) |
Description and Uses
4-n-Pentyloxybenzaldehyde is an organic aldehyde compound primarily employed in the field of organic synthesis for the preparation of other heterocyclic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| TSCA | TSCA listed |
| HS Code | 2912.49.2600 |
| HazardClass | IRRITANT |
