BD0335932
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethoxy)acetic acid , 97% , 260367-12-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB77.60 | In Stock |
|
| 250mg | RMB127.20 | In Stock |
|
| 1g | RMB278.40 | In Stock |
|
| 5g | RMB996.00 | In Stock |
|
| 25g | RMB4144.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-89° |
| Boiling point: | 602.6±40.0 °C(Predicted) |
| Density | 1.287±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.43±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C19H19NO5/c21-18(22)12-24-10-9-20-19(23)25-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17H,9-12H2,(H,20,23)(H,21,22) |
| InChIKey | LBVXPUINIMIGAU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)COCCNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
Fmoc-NH-PEG1-CH2COOH is a degradable ADC linker for antibody drug conjugate (ADC) synthesis. Fmoc-NH-PEG1-CH2COOH is also a PEG-based PROTAC linker that can be used for PROTAC synthesis.
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethoxy)acetic Acid can be used as reactant/reagent in modular platform to develop peptoid-based selective fluorescent metal sensors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| HS Code | 2922390090 |






