BD0340753
2-Chloro-4-fluorobenzoylchloride , 98% , 21900-54-9
CAS NO.:21900-54-9
Empirical Formula: C7H3Cl2FO
Molecular Weight: 193
MDL number: MFCD00084954
EINECS: 623-229-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB44.00 | In Stock |
|
| 25g | RMB155.20 | In Stock |
|
| 100g | RMB610.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 16 °C |
| Boiling point: | 98-102 °C (15 mmHg) |
| Density | 1.447 g/mL at 25 °C |
| refractive index | 1.549-1.551 |
| Flash point: | 82-84°C/15mm |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2254071 |
| InChI | InChI=1S/C7H3Cl2FO/c8-6-3-4(10)1-2-5(6)7(9)11/h1-3H |
| InChIKey | POIAZJJVWRVLBO-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 21900-54-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-29-22 |
| Safety Statements | 45-36/37/39-26 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





