PRODUCT Properties
| Melting point: | 214 °C |
| Boiling point: | 341.5±44.0 °C(Predicted) |
| Density | 1.450±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 9.53±0.26(Predicted) |
| BRN | 1102429 |
| InChI | InChI=1S/C7H8N2OS/c8-7(11)9-5-1-3-6(10)4-2-5/h1-4,10H,(H3,8,9,11) |
| InChIKey | QICKOOCQSYZYQB-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(O)C=C1)C(N)=S |
| CAS DataBase Reference | 1520-27-0(CAS DataBase Reference) |
Description and Uses
1-(4-Hydroxyphenyl)thiourea is an intermediate in the synthesis of (SKI II), a nonlipid inhibitor of sphingosine kinase. SKI II s orally bioavailable and has shown significant inhibition of tumor growth in mice.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Risk Statements | 22 |
| Safety Statements | 22-36/37 |
| RTECS | YT5250000 |
| HazardClass | IRRITANT |
| Toxicity | mouse,LD50,intraperitoneal,100mg/kg (100mg/kg),National Technical Information Service. Vol. AD277-689, |
