PRODUCT Properties
| Melting point: | 174-178 °C (lit.) |
| Boiling point: | 317 °C (lit.) |
| Density | 1.384 |
| refractive index | 1.5880 (estimate) |
| Flash point: | 317°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 15.09±0.50(Predicted) |
| color | White to Orange to Green |
| BRN | 1950928 |
| InChI | 1S/C7H6N2O3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H,(H2,8,10) |
| InChIKey | KLGQWSOYKYFBTR-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccccc1[N+]([O-])=O |
| CAS DataBase Reference | 610-15-1(CAS DataBase Reference) |
| EPA Substance Registry System | o-Nitrobenzamide (610-15-1) |
Description and Uses
2-Nitrobenzamide was used in the synthesis of novel fluorogenic chemosensors based on urea derivative of 2-(2′-aminophenyl)-4-phenylthiazole. It was also used in the synthesis of quinazoline-2,4(1H,3H)-diones, an important class of pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a-P264-P270-P301+P312+P330-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | CV5600000 |
| HS Code | 29242998 |
| Storage Class | 11 - Combustible Solids |







