BD0352145
4-AcetylbenzenesulfonylChloride , 97% , 1788-10-9
Synonym(s):
Acetophenone-4-sulfonyl chloride
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB65.60 | In Stock |
|
| 250mg | RMB103.20 | In Stock |
|
| 1g | RMB154.40 | In Stock |
|
| 5g | RMB637.60 | In Stock |
|
| 10g | RMB1209.60 | In Stock |
|
| 25g | RMB2304.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-87 °C |
| Boiling point: | 338.6±25.0 °C(Predicted) |
| Density | 1.3949 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Sparingly), Methanol (Slightly) |
| form | Powder and/or Chunks |
| color | White to orange to brown |
| Water Solubility | Soluble in water (201.8 mg/L) 25°C. |
| Sensitive | Moisture Sensitive |
| BRN | 2099148 |
| InChI | 1S/C8H7ClO3S/c1-6(10)7-2-4-8(5-3-7)13(9,11)12/h2-5H,1H3 |
| InChIKey | FXVDNCRTKXMSEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(cc1)S(Cl)(=O)=O |
| CAS DataBase Reference | 1788-10-9(CAS DataBase Reference) |
Description and Uses
4-Acetylbenzenesulfonyl chloride is used as a sulfanilamide drug intermediary
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-25-36 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| HazardClass | CORROSIVE |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





