BD4799441
4-Isopropylbenzenesulfonylchloride , 96% , 54997-90-9
CAS NO.:54997-90-9
Empirical Formula: C9H11ClO2S
Molecular Weight: 218.7
MDL number: MFCD00041510
EINECS: 629-255-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB60.00 | In Stock |
|
| 5g | RMB80.00 | In Stock |
|
| 25g | RMB218.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-52 °C |
| Boiling point: | 142-143 °C (12 mmHg) |
| Density | 1.220 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 143 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | low melting solid |
| color | Light orange/brown |
| Sensitive | Moisture Sensitive |
| BRN | 1103862 |
| InChI | 1S/C9H11ClO2S/c1-7(2)8-3-5-9(6-4-8)13(10,11)12/h3-7H,1-2H3 |
| InChIKey | CETRNHJIXGITKR-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(cc1)S(Cl)(=O)=O |
| CAS DataBase Reference | 54997-90-9(CAS DataBase Reference) |
Description and Uses
4-Isopropylbenzenesulfonyl chloride may be used to synthesize chlorosulfonyl-functionalized ATRP (Atom transfer radical polymerization) initiator and 4-isopropylbenzenethiol.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-29 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







