BD0356348
Diloxanidefuroate , 98+% , 3736-81-0
Synonym(s):
2,2-Dichloro-N-(4-hydroxyphenyl)-N-methylacetamide 2-furoic acid ester
CAS NO.：3736-81-0
Empirical Formula: C14H11Cl2NO4
Molecular Weight: 328.15
MDL number: MFCD00083302
EINECS: 223-108-1
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB504.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-114 °C |
| Boiling point: | 438.4±45.0 °C(Predicted) |
| Density | 1.424±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -0?+-.0.50(Predicted) |
| form | Solid |
| color | Off-White to Light Beige |
| BCS Class | 4 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C14H11Cl2NO4/c1-17(13(18)12(15)16)9-4-6-10(7-5-9)21-14(19)11-3-2-8-20-11/h2-8,12H,1H3 |
| InChIKey | BDYYDXJSHYEDGB-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C(Cl)Cl)c1ccc(OC(=O)c2ccco2)cc1 |
| CAS DataBase Reference | 3736-81-0(CAS DataBase Reference) |
Description and Uses
Furamide is an ambecide, an anti-protozoal drug used in the treatment of amoebozoa infections.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | LV1821800 |
| HS Code | 2924296000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | mouse,LDLo,oral,710mg/kg (710mg/kg),Archives of Environmental Contamination and Toxicology. Vol. 14, Pg. 111, 1985. |
