PRODUCT Properties
| Boiling point: | 383.740±32.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.284±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 2.293±0.16(predicted) |
| color | White to pale yellow |
| InChI | InChI=1/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14)/t10-/s3 |
| InChIKey | NHTGHBARYWONDQ-JQHDBZEONA-N |
| SMILES | OC(=O)[C@@](C)(CC1C=CC(O)=CC=1)N |&1:3,r| |
Description and Uses
α-Methyl-D-tyrosine is a derivative of tyrosine used in enantioselective hydrolysis of amino acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P261-P281-P305+P351+P338 |
| Risk Statements | 22-38-40-48/20/22 |
| Safety Statements | 36/37 |
| TSCA | No |






