A8423632
alpha-Methyl-L-tyrosine , ≧95% , 672-87-7
Synonym(s):
α-Methyl-L -tyrosine;L -2-Methyl-3-(4-hydroxy-phenyl)alanine;L -AMPT;Metirosine
CAS NO.:672-87-7
Empirical Formula: C10H13NO3
Molecular Weight: 195.22
MDL number: MFCD00064201
EINECS: 211-599-5
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB479.20 | In Stock |
|
| 250mg | RMB1039.20 | In Stock |
|
| 1g | RMB2959.20 | In Stock |
|
| 5g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 320-340°C dec. |
| Boiling point: | 383.7±32.0 °C(Predicted) |
| Density | 1.283±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Aqueous Acid (Slightly) |
| pka | pKa 2.7 (Uncertain);10.1 (Uncertain) |
| form | Powder |
| color | White to pale yellow |
| optical activity | -3.60°(C=0.01g/ml 1N HCL) |
| Merck | 13,6183 |
| BRN | 2368400 |
| InChI | InChI=1/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14)/t10-/s3 |
| InChIKey | NHTGHBARYWONDQ-JTQLQIEISA-N |
| SMILES | C(C1C=CC(O)=CC=1)[C@@](N)(C)C(=O)O |&1:8,r| |
| CAS DataBase Reference | 672-87-7(CAS DataBase Reference) |
Description and Uses
α-Methyl-L-tyrosine is used to determine whether Fe2/ methamphetamine (METH) -induced cell death is dependent on cytosolic dopamine and iron mediated oxidative stress.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P261-P281-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22-38-40-48/20/22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 2922504500 |
| Storage Class | 11 - Combustible Solids |





